C25H25N3O2S — CID 163550998
(2R)-2-[[5-(4-aminophenyl)-2,3-dihydro-1-benzofuran-7-yl]sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 163550998) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is (2R)-2-[[5-(4-aminophenyl)-2,3-dihydro-1-benzofuran-7-yl]sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | (2R)-2-[[5-(4-aminophenyl)-2,3-dihydro-1-benzofuran-7-yl]sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 163550998 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2R)-2-[[5-(4-aminophenyl)-2,3-dihydro-1-benzofuran-7-yl]sulfanylamino]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | Nc1ccc(-c2cc3c(c(SN[C@@H](CO)Cc4c[nH]c5ccccc45)c2)OCC3)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c26-20-7-5-16(6-8-20)18-11-17-9-10-30-25(17)24(13-18)31-28-21(15-29)12-19-14-27-23-4-2-1-3-22(19)23/h1-8,11,13-14,21,27-29H,9-10,12,15,26H2/t21-/m1/s1 |
| InChIKey | FJBKITZZRRBPLR-OAQYLSRUSA-N |
| XLogP | 4.55 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|