C14H12O6 — CID 163551168
14-hydroxy-5,13-dioxapentacyclo[8.5.1.02,9.03,7.011,15]hexadec-7-ene-4,6,12-trione (PubChem CID 163551168) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 14-hydroxy-5,13-dioxapentacyclo[8.5.1.02,9.03,7.011,15]hexadec-7-ene-4,6,12-trione.
| Compound Name | 14-hydroxy-5,13-dioxapentacyclo[8.5.1.02,9.03,7.011,15]hexadec-7-ene-4,6,12-trione |
|---|---|
| PubChem CID | 163551168 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 14-hydroxy-5,13-dioxapentacyclo[8.5.1.02,9.03,7.011,15]hexadec-7-ene-4,6,12-trione |
| SMILES | O=C1OC(=O)C2C1=CC1C3CC(C21)C1C(O)OC(=O)C31 |
| InChI | InChI=1S/C14H12O6/c15-11-6-2-3-4-1-5(7(3)10(6)14(18)19-11)9-8(4)12(16)20-13(9)17/h2-5,7-10,13,17H,1H2 |
| InChIKey | FJEWJSGPOIIMNQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|