C25H25ClO — CID 163551176
2-(5-chloro-2-methoxyphenyl)-9,9,10,10-tetramethylphenanthrene (PubChem CID 163551176) has the molecular formula C25H25ClO and a molecular weight of 376.93 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-9,9,10,10-tetramethylphenanthrene.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-9,9,10,10-tetramethylphenanthrene |
|---|---|
| PubChem CID | 163551176 |
| Molecular Formula | C25H25ClO |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-9,9,10,10-tetramethylphenanthrene |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(C)(C)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C25H25ClO/c1-24(2)21-9-7-6-8-18(21)19-12-10-16(14-22(19)25(24,3)4)20-15-17(26)11-13-23(20)27-5/h6-15H,1-5H3 |
| InChIKey | ZYOQTWRBDPRENI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |