About 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide
5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide (PubChem CID 163551632) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide.
Molecular Properties
| Compound Name | 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide |
| PubChem CID | 163551632 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide |
| SMILES | [H]N=S1(=O)CCCc2nc(C)ncc21 |
| InChI | InChI=1S/C8H11N3OS/c1-6-10-5-8-7(11-6)3-2-4-13(8,9)12/h5,9H,2-4H2,1H3 |
| InChIKey | FJNXDMPYJVDLJO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide?
The IUPAC name of 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide (CID 163551632) is 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide.
What is the SMILES notation for 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide?
The canonical SMILES for 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide is [H]N=S1(=O)CCCc2nc(C)ncc21.
What is the InChIKey of 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide?
The InChIKey is FJNXDMPYJVDLJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c1-6-10-5-8-7(11-6)3-2-4-13(8,9)12/h5,9H,2-4H2,1H3.
What are the key properties of 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide?
5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide has a molecular weight of 197.26 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-2-methyl-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine 5-oxide is sourced from PubChem (CID 163551632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).