C14H14BrNO2S — CID 163551701
methyl (2E,4E)-6-(5-bromo-1,3-thiazol-2-yl)-2-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate (PubChem CID 163551701) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is methyl (2E,4E)-6-(5-bromo-1,3-thiazol-2-yl)-2-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E)-6-(5-bromo-1,3-thiazol-2-yl)-2-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 163551701 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | methyl (2E,4E)-6-(5-bromo-1,3-thiazol-2-yl)-2-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate |
| SMILES | C=C(/C=C/C=C(\C=C/C)C(=O)OC)c1ncc(Br)s1 |
| InChI | InChI=1S/C14H14BrNO2S/c1-4-6-11(14(17)18-3)8-5-7-10(2)13-16-9-12(15)19-13/h4-9H,2H2,1,3H3/b6-4-,7-5+,11-8+ |
| InChIKey | FJPRVKHYTCBWPT-LFENBZGZSA-N |
| XLogP | 4.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|