C11H15ClN+ — CID 163552532
(2-ethyl-1,2,3,4-tetrahydroquinolin-6-yl)chloranium (PubChem CID 163552532) has the molecular formula C11H15ClN+ and a molecular weight of 196.70 g/mol. Its IUPAC name is (2-ethyl-1,2,3,4-tetrahydroquinolin-6-yl)chloranium.
| Compound Name | (2-ethyl-1,2,3,4-tetrahydroquinolin-6-yl)chloranium |
|---|---|
| PubChem CID | 163552532 |
| Molecular Formula | C11H15ClN+ |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2-ethyl-1,2,3,4-tetrahydroquinolin-6-yl)chloranium |
| SMILES | CCC1CCc2cc([ClH+])ccc2N1 |
| InChI | InChI=1S/C11H15ClN/c1-2-10-5-3-8-7-9(12)4-6-11(8)13-10/h4,6-7,10,12-13H,2-3,5H2,1H3/q+1 |
| InChIKey | FKGCUVPPNMFVBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |