About 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane
14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane (PubChem CID 163554439) has the molecular formula C15H27BO3
and a molecular weight of 266.19 g/mol. Its IUPAC name is 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane.
Molecular Properties
| Compound Name | 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane |
| PubChem CID | 163554439 |
| Molecular Formula | C15H27BO3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane |
| SMILES | CC(C)(C)B1OC2(CCCCC2)C2(CCOCC2)O1 |
| InChI | InChI=1S/C15H27BO3/c1-13(2,3)16-18-14(7-5-4-6-8-14)15(19-16)9-11-17-12-10-15/h4-12H2,1-3H3 |
| InChIKey | NCPAHELDHXQMSN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane?
The IUPAC name of 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane (CID 163554439) is 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane.
What is the SMILES notation for 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane?
The canonical SMILES for 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane is CC(C)(C)B1OC2(CCCCC2)C2(CCOCC2)O1.
What is the InChIKey of 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane?
The InChIKey is NCPAHELDHXQMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BO3/c1-13(2,3)16-18-14(7-5-4-6-8-14)15(19-16)9-11-17-12-10-15/h4-12H2,1-3H3.
What are the key properties of 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane?
14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane has a molecular weight of 266.19 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14-tert-butyl-10,13,15-trioxa-14-boradispiro[5.0.57.36]pentadecane is sourced from PubChem (CID 163554439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).