C6H14N4 — CID 163554564
2-(aminomethyl)-1-N'-methylbuta-1,3-diene-1,1,4-triamine (PubChem CID 163554564) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is 2-(aminomethyl)-1-N'-methylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | 2-(aminomethyl)-1-N'-methylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 163554564 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 2-(aminomethyl)-1-N'-methylbuta-1,3-diene-1,1,4-triamine |
| SMILES | CNC(N)=C(C=CN)CN |
| InChI | InChI=1S/C6H14N4/c1-10-6(9)5(4-8)2-3-7/h2-3,10H,4,7-9H2,1H3 |
| InChIKey | FLXKGPJQKSCIRJ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|