C9H14O4 — CID 163554872
(8R,9R)-4-oxadispiro[2.1.25.33]decane-6,8,9-triol (PubChem CID 163554872) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (8R,9R)-4-oxadispiro[2.1.25.33]decane-6,8,9-triol.
| Compound Name | (8R,9R)-4-oxadispiro[2.1.25.33]decane-6,8,9-triol |
|---|---|
| PubChem CID | 163554872 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (8R,9R)-4-oxadispiro[2.1.25.33]decane-6,8,9-triol |
| SMILES | OC1CC12OC1(CC1)C[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H14O4/c10-5-3-8(1-2-8)13-9(7(5)12)4-6(9)11/h5-7,10-12H,1-4H2/t5-,6?,7-,9?/m1/s1 |
| InChIKey | FMEIOEXDNTZALN-DOBFWROPSA-N |
| XLogP | -0.84 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |