About (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol
(E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol (PubChem CID 163555305) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol.
Molecular Properties
| Compound Name | (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol |
| PubChem CID | 163555305 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol |
| SMILES | CC/C(C)=C/C(=C\NCC(F)F)CO |
| InChI | InChI=1S/C10H17F2NO/c1-3-8(2)4-9(7-14)5-13-6-10(11)12/h4-5,10,13-14H,3,6-7H2,1-2H3/b8-4+,9-5+ |
| InChIKey | FMNCDWGYNDUDDR-KBXRYBNXSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol?
The IUPAC name of (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol (CID 163555305) is (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol.
What is the SMILES notation for (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol?
The canonical SMILES for (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol is CC/C(C)=C/C(=C\NCC(F)F)CO.
What is the InChIKey of (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol?
The InChIKey is FMNCDWGYNDUDDR-KBXRYBNXSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-3-8(2)4-9(7-14)5-13-6-10(11)12/h4-5,10,13-14H,3,6-7H2,1-2H3/b8-4+,9-5+.
What are the key properties of (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol?
(E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol has a molecular weight of 205.25 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2E)-2-[(2,2-difluoroethylamino)methylidene]-4-methylhex-3-en-1-ol is sourced from PubChem (CID 163555305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).