C5H5F6NO — CID 163555520
4-amino-1,1,1,5,5,5-hexafluoropentan-2-one (PubChem CID 163555520) has the molecular formula C5H5F6NO and a molecular weight of 209.09 g/mol. Its IUPAC name is 4-amino-1,1,1,5,5,5-hexafluoropentan-2-one.
| Compound Name | 4-amino-1,1,1,5,5,5-hexafluoropentan-2-one |
|---|---|
| PubChem CID | 163555520 |
| Molecular Formula | C5H5F6NO |
| Molecular Weight | 209.09 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 4-amino-1,1,1,5,5,5-hexafluoropentan-2-one |
| SMILES | NC(CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5F6NO/c6-4(7,8)2(12)1-3(13)5(9,10)11/h2H,1,12H2 |
| InChIKey | FMRWDINKQYKMDW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.09 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |