C37H44IN4O5S- — CID 163556343
CID 163556343 (PubChem CID 163556343) has the molecular formula C37H44IN4O5S- and a molecular weight of 783.75 g/mol.
| Compound Name | CID 163556343 |
|---|---|
| PubChem CID | 163556343 |
| Molecular Formula | C37H44IN4O5S- |
| Molecular Weight | 783.75 g/mol |
| Exact Mass | 783.21 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)[C@H]1CC[C@@]1(C(=O)N1C3CCC1[I-]N(C)C3)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)C3CC3)cc21 |
| InChI | InChI=1S/C37H44IN4O5S/c1-40-20-24-9-15-32(38-40)42(24)36(44)37-17-16-30(37)29-19-25(47-2)10-14-27(29)34-33(22-6-4-3-5-7-22)28-13-8-23(18-31(28)41(34)21-37)35(43)39-48(45,46)26-11-12-26/h8,10,13-14,18-19,22,24,26,30,32H,3-7,9,11-12,15-17,20-21H2,1-2H3,(H,39,43)/q-1/t24?,30-,32?,37-/m1/s1 |
| InChIKey | JHIWSFCGQGROES-JHJVSSLGSA-N |
| XLogP | 2.73 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|