About 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole
4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole (PubChem CID 163556464) has the molecular formula C10H10ClNS
and a molecular weight of 211.72 g/mol. Its IUPAC name is 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole |
| PubChem CID | 163556464 |
| Molecular Formula | C10H10ClNS |
| Molecular Weight | 211.72 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole |
| SMILES | Cc1scnc1C1C=CC=CC1Cl |
| InChI | InChI=1S/C10H10ClNS/c1-7-10(12-6-13-7)8-4-2-3-5-9(8)11/h2-6,8-9H,1H3 |
| InChIKey | FNMHVGKLABRRIM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole?
The IUPAC name of 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole (CID 163556464) is 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole.
What is the SMILES notation for 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole?
The canonical SMILES for 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole is Cc1scnc1C1C=CC=CC1Cl.
What is the InChIKey of 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole?
The InChIKey is FNMHVGKLABRRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNS/c1-7-10(12-6-13-7)8-4-2-3-5-9(8)11/h2-6,8-9H,1H3.
What are the key properties of 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole?
4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole has a molecular weight of 211.72 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chlorocyclohexa-2,4-dien-1-yl)-5-methyl-1,3-thiazole is sourced from PubChem (CID 163556464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).