C25H26F3N2O3+ — CID 163556544
[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]-[3-[hydroxy(morpholin-4-ium-4-ylidene)methyl]-2,6-dimethylphenyl]methanone (PubChem CID 163556544) has the molecular formula C25H26F3N2O3+ and a molecular weight of 459.49 g/mol. Its IUPAC name is [1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]-[3-[hydroxy(morpholin-4-ium-4-ylidene)methyl]-2,6-dimethylphenyl]methanone.
| Compound Name | [1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]-[3-[hydroxy(morpholin-4-ium-4-ylidene)methyl]-2,6-dimethylphenyl]methanone |
|---|---|
| PubChem CID | 163556544 |
| Molecular Formula | C25H26F3N2O3+ |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]-[3-[hydroxy(morpholin-4-ium-4-ylidene)methyl]-2,6-dimethylphenyl]methanone |
| SMILES | Cc1ccc(C(O)=[N+]2CCOCC2)c(C)c1C(=O)c1cc2c(C)cc(C(F)(F)F)cc2n1C |
| InChI | InChI=1S/C25H25F3N2O3/c1-14-5-6-18(24(32)30-7-9-33-10-8-30)16(3)22(14)23(31)21-13-19-15(2)11-17(25(26,27)28)12-20(19)29(21)4/h5-6,11-13H,7-10H2,1-4H3/p+1 |
| InChIKey | FNNYJRBYDQFIFG-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 54.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|