C32H38N6O8 — CID 163556783
4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-methoxy-1H-indole-2-carbonyl)amino]methyl]butanedioate (PubChem CID 163556783) has the molecular formula C32H38N6O8 and a molecular weight of 634.69 g/mol. Its IUPAC name is 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-methoxy-1H-indole-2-carbonyl)amino]methyl]butanedioate.
| Compound Name | 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-methoxy-1H-indole-2-carbonyl)amino]methyl]butanedioate |
|---|---|
| PubChem CID | 163556783 |
| Molecular Formula | C32H38N6O8 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-methoxy-1H-indole-2-carbonyl)amino]methyl]butanedioate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N[C@H](NC(=O)c3[nH]c4ccccc4c3OC)C(CC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C32H38N6O8/c1-4-5-14-45-26(40)17-22(32(42)44-3)30(37-31(41)27-28(43-2)21-8-6-7-9-23(21)35-27)36-25(39)16-20-15-24(38-46-20)18-10-12-19(13-11-18)29(33)34/h6-13,20,22,30,35H,4-5,14-17H2,1-3H3,(H3,33,34)(H,36,39)(H,37,41)/t20?,22?,30-/m1/s1 |
| InChIKey | RSDZFGDJXICXQU-QNGNIAIQSA-N |
| XLogP | 2.74 |
| TPSA | 207.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|