C11H19N3 — CID 163556785
(1E,3E,5E)-6-(butan-2-ylideneamino)-1-N-methylhexa-1,3,5-triene-1,3-diamine (PubChem CID 163556785) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1E,3E,5E)-6-(butan-2-ylideneamino)-1-N-methylhexa-1,3,5-triene-1,3-diamine.
| Compound Name | (1E,3E,5E)-6-(butan-2-ylideneamino)-1-N-methylhexa-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 163556785 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1E,3E,5E)-6-(butan-2-ylideneamino)-1-N-methylhexa-1,3,5-triene-1,3-diamine |
| SMILES | CC/C(C)=N/C=C/C=C(N)\C=C\NC |
| InChI | InChI=1S/C11H19N3/c1-4-10(2)14-8-5-6-11(12)7-9-13-3/h5-9,13H,4,12H2,1-3H3/b8-5+,9-7+,11-6+,14-10+ |
| InChIKey | FNTHOYSXWVDOMB-KKTWDLFGSA-N |
| XLogP | 1.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|