About 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol
8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol (PubChem CID 163557068) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol.
Molecular Properties
| Compound Name | 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol |
| PubChem CID | 163557068 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol |
| SMILES | CC1(C)C2C(O)OC3OC3C21 |
| InChI | InChI=1S/C8H12O3/c1-8(2)3-4(8)6(9)11-7-5(3)10-7/h3-7,9H,1-2H3 |
| InChIKey | FNZJAVJDHVKPCI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol?
The IUPAC name of 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol (CID 163557068) is 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol.
What is the SMILES notation for 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol?
The canonical SMILES for 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol is CC1(C)C2C(O)OC3OC3C21.
What is the InChIKey of 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol?
The InChIKey is FNZJAVJDHVKPCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-8(2)3-4(8)6(9)11-7-5(3)10-7/h3-7,9H,1-2H3.
What are the key properties of 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol?
8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol has a molecular weight of 156.18 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-3,5-dioxatricyclo[5.1.0.02,4]octan-6-ol is sourced from PubChem (CID 163557068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).