C26H54OSiSn — CID 163558339
triethyl-[(1E,5E)-1-tributylstannylocta-1,5-dien-4-yl]oxysilane (PubChem CID 163558339) has the molecular formula C26H54OSiSn and a molecular weight of 529.51 g/mol. Its IUPAC name is triethyl-[(1E,5E)-1-tributylstannylocta-1,5-dien-4-yl]oxysilane.
| Compound Name | triethyl-[(1E,5E)-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 163558339 |
| Molecular Formula | C26H54OSiSn |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | triethyl-[(1E,5E)-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
| SMILES | CC/C=C/C(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H27OSi.3C4H9.Sn/c1-6-11-13-14(12-7-2)15-16(8-3,9-4)10-5;3*1-3-4-2;/h2,7,11,13-14H,6,8-10,12H2,1,3-5H3;3*1,3-4H2,2H3;/b7-2?,13-11+;;;; |
| InChIKey | FPAQDDWORAPNCS-LQRQQSBFSA-N |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|