C30H23BF4N3O5 — CID 163560549
CID 163560549 (PubChem CID 163560549) has the molecular formula C30H23BF4N3O5 and a molecular weight of 592.33 g/mol.
| Compound Name | CID 163560549 |
|---|---|
| PubChem CID | 163560549 |
| Molecular Formula | C30H23BF4N3O5 |
| Molecular Weight | 592.33 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | — |
| SMILES | CO[C@](O)(CNC(=O)c1cc(OC2CC2)c2ncccc2c1)c1cc2c(c(-c3ccc(F)cc3)n1)OC1[B][C@@]21C(F)(F)F |
| InChI | InChI=1S/C30H23BF4N3O5/c1-41-28(40,14-37-26(39)17-11-16-3-2-10-36-23(16)21(12-17)42-19-8-9-19)22-13-20-25(43-27-29(20,31-27)30(33,34)35)24(38-22)15-4-6-18(32)7-5-15/h2-7,10-13,19,27,40H,8-9,14H2,1H3,(H,37,39)/t27?,28-,29+/m1/s1 |
| InChIKey | MQRZYNLZIVSUEG-WUFLDLQOSA-N |
| XLogP | 4.39 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|