C15H22N2 — CID 163560840
3-(4,4-dimethylpentyl)-6-methyl-2H-indazole (PubChem CID 163560840) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-6-methyl-2H-indazole.
| Compound Name | 3-(4,4-dimethylpentyl)-6-methyl-2H-indazole |
|---|---|
| PubChem CID | 163560840 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-6-methyl-2H-indazole |
| SMILES | Cc1ccc2c(CCCC(C)(C)C)[nH]nc2c1 |
| InChI | InChI=1S/C15H22N2/c1-11-7-8-12-13(16-17-14(12)10-11)6-5-9-15(2,3)4/h7-8,10H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | JVSNQZRWDPCXST-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |