C23H30N6O4 — CID 163561264
2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(2-methoxyethoxy)-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide (PubChem CID 163561264) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(2-methoxyethoxy)-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide.
| Compound Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(2-methoxyethoxy)-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 163561264 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(2-methoxyethoxy)-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide |
| SMILES | CC/C=C/Cn1c(NC(=O)c2cc(C)nn2CC)nc2cc(C(N)=O)cc(OCCOC)c21 |
| InChI | InChI=1S/C23H30N6O4/c1-5-7-8-9-28-20-17(13-16(21(24)30)14-19(20)33-11-10-32-4)25-23(28)26-22(31)18-12-15(3)27-29(18)6-2/h7-8,12-14H,5-6,9-11H2,1-4H3,(H2,24,30)(H,25,26,31)/b8-7+ |
| InChIKey | FRKCEZVCUFSOTI-BQYQJAHWSA-N |
| XLogP | 2.90 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|