About CID 163561418
CID 163561418 (PubChem CID 163561418) has the molecular formula C3H8AlN2O
and a molecular weight of 115.09 g/mol.
Molecular Properties
| Compound Name | CID 163561418 |
| PubChem CID | 163561418 |
| Molecular Formula | C3H8AlN2O |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | — |
| SMILES | COC(C)=N[Al]N |
| InChI | InChI=1S/C3H6NO.Al.H2N/c1-3(4)5-2;;/h1-2H3;;1H2/q-1;+2;-1 |
| InChIKey | OBVLFYSFLKIPRI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 163561418 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163561418?
The IUPAC name of CID 163561418 (CID 163561418) is not available.
What is the SMILES notation for CID 163561418?
The canonical SMILES for CID 163561418 is COC(C)=N[Al]N.
What is the InChIKey of CID 163561418?
The InChIKey is OBVLFYSFLKIPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO.Al.H2N/c1-3(4)5-2;;/h1-2H3;;1H2/q-1;+2;-1.
What are the key properties of CID 163561418?
CID 163561418 has a molecular weight of 115.09 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163561418 is sourced from PubChem (CID 163561418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).