C19H16N4 — CID 163561716
(5Z,9Z)-4,21,22,23-tetrahydro-3H-corrin (PubChem CID 163561716) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is (5Z,9Z)-4,21,22,23-tetrahydro-3H-corrin.
| Compound Name | (5Z,9Z)-4,21,22,23-tetrahydro-3H-corrin |
|---|---|
| PubChem CID | 163561716 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (5Z,9Z)-4,21,22,23-tetrahydro-3H-corrin |
| SMILES | C1=CC2=NC1=Cc1ccc([nH]1)/C=c1/cc/c([nH]1)=C/C1CC=C2N1 |
| InChI | InChI=1S/C19H16N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h1-5,7-11,17,20-21,23H,6H2/b13-9-,15-11-,16-10? |
| InChIKey | DGCXPHDGLOUICI-XWCGUGMYSA-N |
| XLogP | 1.56 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |