About CID 163561884
CID 163561884 (PubChem CID 163561884) has the molecular formula C4H11IN2O2
and a molecular weight of 246.05 g/mol.
Molecular Properties
| Compound Name | CID 163561884 |
| PubChem CID | 163561884 |
| Molecular Formula | C4H11IN2O2 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | — |
| SMILES | C[NH+]([O-])CCC[N+](=O)[IH-] |
| InChI | InChI=1S/C4H10IN2O2/c1-6(8)3-2-4-7(5)9/h6H,2-4H2,1H3 |
| InChIKey | OBDOUZXAJFTNEG-UHFFFAOYSA-N |
| XLogP | -4.63 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 163561884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163561884?
The IUPAC name of CID 163561884 (CID 163561884) is not available.
What is the SMILES notation for CID 163561884?
The canonical SMILES for CID 163561884 is C[NH+]([O-])CCC[N+](=O)[IH-].
What is the InChIKey of CID 163561884?
The InChIKey is OBDOUZXAJFTNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10IN2O2/c1-6(8)3-2-4-7(5)9/h6H,2-4H2,1H3.
What are the key properties of CID 163561884?
CID 163561884 has a molecular weight of 246.05 g/mol, XLogP of -4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163561884 is sourced from PubChem (CID 163561884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).