C26H29N4S+ — CID 163561903
2-[[1-methyl-2-(4-methylpiperazin-1-yl)quinolin-1-ium-4-yl]methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (PubChem CID 163561903) has the molecular formula C26H29N4S+ and a molecular weight of 429.61 g/mol. Its IUPAC name is 2-[[1-methyl-2-(4-methylpiperazin-1-yl)quinolin-1-ium-4-yl]methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
| Compound Name | 2-[[1-methyl-2-(4-methylpiperazin-1-yl)quinolin-1-ium-4-yl]methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
|---|---|
| PubChem CID | 163561903 |
| Molecular Formula | C26H29N4S+ |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[[1-methyl-2-(4-methylpiperazin-1-yl)quinolin-1-ium-4-yl]methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
| SMILES | CN1CCN(c2cc(C=C3Sc4cccc5c4N3CCC5)c3ccccc3[n+]2C)CC1 |
| InChI | InChI=1S/C26H29N4S/c1-27-13-15-29(16-14-27)24-17-20(21-9-3-4-10-22(21)28(24)2)18-25-30-12-6-8-19-7-5-11-23(31-25)26(19)30/h3-5,7,9-11,17-18H,6,8,12-16H2,1-2H3/q+1 |
| InChIKey | FRXNJBSDQCYYMA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|