C11H13F5O7S — CID 163561958
1,1-difluoro-2-[3-[2-(trifluoromethyl)prop-2-enoyloxy]pentanoyloxy]ethanesulfonic acid (PubChem CID 163561958) has the molecular formula C11H13F5O7S and a molecular weight of 384.28 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-[2-(trifluoromethyl)prop-2-enoyloxy]pentanoyloxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-[2-(trifluoromethyl)prop-2-enoyloxy]pentanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 163561958 |
| Molecular Formula | C11H13F5O7S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 1,1-difluoro-2-[3-[2-(trifluoromethyl)prop-2-enoyloxy]pentanoyloxy]ethanesulfonic acid |
| SMILES | C=C(C(=O)OC(CC)CC(=O)OCC(F)(F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H13F5O7S/c1-3-7(23-9(18)6(2)11(14,15)16)4-8(17)22-5-10(12,13)24(19,20)21/h7H,2-5H2,1H3,(H,19,20,21) |
| InChIKey | FRYKTWJAHJNDKO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|