About 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene
5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene (PubChem CID 163563049) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene |
| PubChem CID | 163563049 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene |
| SMILES | CCOC1(F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C9H11F3O/c1-2-13-9(12)7-4-3-6(5-7)8(9,10)11/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | FSWPWIOMISFVNT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene (CID 163563049) is 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene is CCOC1(F)C2C=CC(C2)C1(F)F.
What is the InChIKey of 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene?
The InChIKey is FSWPWIOMISFVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O/c1-2-13-9(12)7-4-3-6(5-7)8(9,10)11/h3-4,6-7H,2,5H2,1H3.
What are the key properties of 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene?
5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene has a molecular weight of 192.18 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 163563049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).