C24H16ClN5 — CID 163563378
6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-isocyano-1H-indol-2-yl)-2-methylidene-1H-1,8-naphthyridine (PubChem CID 163563378) has the molecular formula C24H16ClN5 and a molecular weight of 409.88 g/mol. Its IUPAC name is 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-isocyano-1H-indol-2-yl)-2-methylidene-1H-1,8-naphthyridine.
| Compound Name | 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-isocyano-1H-indol-2-yl)-2-methylidene-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 163563378 |
| Molecular Formula | C24H16ClN5 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-isocyano-1H-indol-2-yl)-2-methylidene-1H-1,8-naphthyridine |
| SMILES | [C-]#[N+]c1ccc2[nH]c(-c3nc4c(cc3-c3cc(C)nc(Cl)c3)C=CC(=C)N4)cc2c1 |
| InChI | InChI=1S/C24H16ClN5/c1-13-4-5-15-10-19(16-8-14(2)27-22(25)12-16)23(30-24(15)28-13)21-11-17-9-18(26-3)6-7-20(17)29-21/h4-12,29H,1H2,2H3,(H,28,30) |
| InChIKey | OYIXSJKHQPHBIR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 57.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|