About [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide
[cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide (PubChem CID 163563649) has the molecular formula C7H10NO-
and a molecular weight of 124.16 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide.
Molecular Properties
| Compound Name | [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide |
| PubChem CID | 163563649 |
| Molecular Formula | C7H10NO- |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.08 |
| IUPAC Name | [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide |
| SMILES | [NH-]C(O)C1C=CC=CC1 |
| InChI | InChI=1S/C7H10NO/c8-7(9)6-4-2-1-3-5-6/h1-4,6-9H,5H2/q-1 |
| InChIKey | FTJOJAJIUYAOAU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide?
The IUPAC name of [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide (CID 163563649) is [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide.
What is the SMILES notation for [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide?
The canonical SMILES for [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide is [NH-]C(O)C1C=CC=CC1.
What is the InChIKey of [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide?
The InChIKey is FTJOJAJIUYAOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10NO/c8-7(9)6-4-2-1-3-5-6/h1-4,6-9H,5H2/q-1.
What are the key properties of [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide?
[cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide has a molecular weight of 124.16 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclohexa-2,4-dien-1-yl(hydroxy)methyl]azanide is sourced from PubChem (CID 163563649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).