C44H49N3O8 — CID 163564129
4-O-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 1-O-[2-methyl-4-[1-oxo-1-(4-tritylpiperazin-1-yl)propan-2-yl]oxybutan-2-yl] butanedioate (PubChem CID 163564129) has the molecular formula C44H49N3O8 and a molecular weight of 747.89 g/mol. Its IUPAC name is 4-O-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 1-O-[2-methyl-4-[1-oxo-1-(4-tritylpiperazin-1-yl)propan-2-yl]oxybutan-2-yl] butanedioate.
| Compound Name | 4-O-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 1-O-[2-methyl-4-[1-oxo-1-(4-tritylpiperazin-1-yl)propan-2-yl]oxybutan-2-yl] butanedioate |
|---|---|
| PubChem CID | 163564129 |
| Molecular Formula | C44H49N3O8 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 747.35 |
| IUPAC Name | 4-O-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 1-O-[2-methyl-4-[1-oxo-1-(4-tritylpiperazin-1-yl)propan-2-yl]oxybutan-2-yl] butanedioate |
| SMILES | CC(OCCC(C)(C)OC(=O)CCC(=O)ON1C(=O)C2C3C=CC(C3)C2C1=O)C(=O)N1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C44H49N3O8/c1-30(53-28-23-43(2,3)54-36(48)21-22-37(49)55-47-41(51)38-31-19-20-32(29-31)39(38)42(47)52)40(50)45-24-26-46(27-25-45)44(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-20,30-32,38-39H,21-29H2,1-3H3 |
| InChIKey | FTTCPOSWEXSYKU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|