C17H31NO7 — CID 163565104
2-[2-[[(3aR,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propoxy]ethanamine (PubChem CID 163565104) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[2-[[(3aR,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propoxy]ethanamine.
| Compound Name | 2-[2-[[(3aR,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propoxy]ethanamine |
|---|---|
| PubChem CID | 163565104 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-[2-[[(3aR,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propoxy]ethanamine |
| SMILES | CC(COCCN)OC1C2OC(C)(C)O[C@H]2O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C17H31NO7/c1-10(8-19-7-6-18)21-13-12(11-9-20-16(2,3)23-11)22-15-14(13)24-17(4,5)25-15/h10-15H,6-9,18H2,1-5H3/t10?,11?,12-,13?,14?,15-/m1/s1 |
| InChIKey | FUNCTTAUHALHRG-KZSNKCBBSA-N |
| XLogP | 0.76 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|