C36H54BBrCl2N9O6S — CID 163566363
CID 163566363 (PubChem CID 163566363) has the molecular formula C36H54BBrCl2N9O6S and a molecular weight of 902.57 g/mol.
| Compound Name | CID 163566363 |
|---|---|
| PubChem CID | 163566363 |
| Molecular Formula | C36H54BBrCl2N9O6S |
| Molecular Weight | 902.57 g/mol |
| Exact Mass | 900.26 |
| IUPAC Name | — |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(Br)nc3Cl)CC2)[C@@H]1NC(=O)OC(C)(C)C.C[C@@H]1OCC2(CCN(c3nccnc3Cl)CC2)[C@@H]1NC(=O)OC(C)(C)C.[B]=NS |
| InChI | InChI=1S/C18H26BrClN4O3.C18H27ClN4O3.BHNS/c1-11-13(23-16(25)27-17(2,3)4)18(10-26-11)5-7-24(8-6-18)15-14(20)22-12(19)9-21-15;1-12-13(22-16(24)26-17(2,3)4)18(11-25-12)5-9-23(10-6-18)15-14(19)20-7-8-21-15;1-2-3/h9,11,13H,5-8,10H2,1-4H3,(H,23,25);7-8,12-13H,5-6,9-11H2,1-4H3,(H,22,24);3H/t11-,13+;12-,13+;/m00./s1 |
| InChIKey | CLKGRUHDCSIKKI-MWIYHBQFSA-N |
| XLogP | 7.00 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|