About 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine
4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine (PubChem CID 163566681) has the molecular formula C28H29NO5
and a molecular weight of 459.54 g/mol. Its IUPAC name is 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine |
| PubChem CID | 163566681 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine |
| SMILES | COc1ccc(COc2cc(COC3=CCNC=C3)cc(OCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H29NO5/c1-30-24-7-3-21(4-8-24)18-33-27-15-23(20-32-26-11-13-29-14-12-26)16-28(17-27)34-19-22-5-9-25(31-2)10-6-22/h3-13,15-17,29H,14,18-20H2,1-2H3 |
| InChIKey | FVUWMLJAZSSEHD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine?
The IUPAC name of 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine (CID 163566681) is 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine.
What is the SMILES notation for 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine?
The canonical SMILES for 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine is COc1ccc(COc2cc(COC3=CCNC=C3)cc(OCc3ccc(OC)cc3)c2)cc1.
What is the InChIKey of 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine?
The InChIKey is FVUWMLJAZSSEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO5/c1-30-24-7-3-21(4-8-24)18-33-27-15-23(20-32-26-11-13-29-14-12-26)16-28(17-27)34-19-22-5-9-25(31-2)10-6-22/h3-13,15-17,29H,14,18-20H2,1-2H3.
What are the key properties of 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine?
4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine has a molecular weight of 459.54 g/mol, XLogP of 5.38, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]methoxy]-1,2-dihydropyridine is sourced from PubChem (CID 163566681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).