C30H29N3O5 — CID 163566867
(2-oxochromen-6-yl) 8-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carboxylate (PubChem CID 163566867) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is (2-oxochromen-6-yl) 8-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carboxylate.
| Compound Name | (2-oxochromen-6-yl) 8-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carboxylate |
|---|---|
| PubChem CID | 163566867 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (2-oxochromen-6-yl) 8-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carboxylate |
| SMILES | CC(C)(C)c1cc(-n2n3c4ccc(C(=O)Oc5ccc6oc(=O)ccc6c5)cc4n23)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H29N3O5/c1-29(2,3)19-15-21(30(4,5)6)27(35)24(16-19)33-31-22-10-7-18(14-23(22)32(31)33)28(36)37-20-9-11-25-17(13-20)8-12-26(34)38-25/h7-16,35H,1-6H3 |
| InChIKey | FVYKENXPMAMJGC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|