C11H10F5N4O2+ — CID 163567969
[amino-[2-cyclopropyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]methylidene]carbamoyloxidanium (PubChem CID 163567969) has the molecular formula C11H10F5N4O2+ and a molecular weight of 325.22 g/mol. Its IUPAC name is [amino-[2-cyclopropyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]methylidene]carbamoyloxidanium.
| Compound Name | [amino-[2-cyclopropyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]methylidene]carbamoyloxidanium |
|---|---|
| PubChem CID | 163567969 |
| Molecular Formula | C11H10F5N4O2+ |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [amino-[2-cyclopropyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]methylidene]carbamoyloxidanium |
| SMILES | NC(=NC(=O)[OH2+])c1cc(C(F)(F)C(F)(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C11H9F5N4O2/c12-10(13,11(14,15)16)6-3-5(7(17)20-9(21)22)18-8(19-6)4-1-2-4/h3-4H,1-2H2,(H2,17,20)(H,21,22)/p+1 |
| InChIKey | FWVNBUYFQNPEKB-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|