C23H27BFN9O7P2S — CID 163567985
CID 163567985 (PubChem CID 163567985) has the molecular formula C23H27BFN9O7P2S and a molecular weight of 665.35 g/mol.
| Compound Name | CID 163567985 |
|---|---|
| PubChem CID | 163567985 |
| Molecular Formula | C23H27BFN9O7P2S |
| Molecular Weight | 665.35 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)CC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2OP(O)(=S)CC[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@@H](O)C2O1 |
| InChI | InChI=1S/C23H27BFN9O7P2S/c24-42(36)5-2-11-17(13(25)22(38-11)33-9-32-15-19(27)29-7-30-21(15)33)41-43(37,44)6-3-12-18(40-42)16(35)23(39-12)34-8-31-14-10(26)1-4-28-20(14)34/h1,4,7-9,11-13,16-18,22-23,35H,2-3,5-6H2,(H2,26,28)(H,37,44)(H2,27,29,30)/t11-,12-,13?,16+,17+,18?,22-,23-,42?,43?/m1/s1 |
| InChIKey | SKGRNZLOXWFUDI-NRKUTENQSA-N |
| XLogP | 1.16 |
| TPSA | 220.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|