C9H15NO3S — CID 163568709
4-[1-(methylamino)ethyl]cyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 163568709) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-[1-(methylamino)ethyl]cyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 4-[1-(methylamino)ethyl]cyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 163568709 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 4-[1-(methylamino)ethyl]cyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CNC(C)C1=CCC(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C9H15NO3S/c1-7(10-2)8-3-5-9(6-4-8)14(11,12)13/h3-5,7,9-10H,6H2,1-2H3,(H,11,12,13) |
| InChIKey | FXJRUSSGORVWRN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|