About [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate
[9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate (PubChem CID 163568957) has the molecular formula C20H30O6
and a molecular weight of 366.45 g/mol. Its IUPAC name is [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate |
| PubChem CID | 163568957 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(O)OC1CCCCC1 |
| InChI | InChI=1S/C20H30O6/c1-3-10(2)18(21)25-16-12-9-13-15(20(23)26-17(13)16)14(12)19(22)24-11-7-5-4-6-8-11/h10-17,19,22H,3-9H2,1-2H3 |
| InChIKey | FXPCXMSCEVTWNG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate?
The IUPAC name of [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate (CID 163568957) is [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate.
What is the SMILES notation for [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate?
The canonical SMILES for [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate is CCC(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(O)OC1CCCCC1.
What is the InChIKey of [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate?
The InChIKey is FXPCXMSCEVTWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O6/c1-3-10(2)18(21)25-16-12-9-13-15(20(23)26-17(13)16)14(12)19(22)24-11-7-5-4-6-8-11/h10-17,19,22H,3-9H2,1-2H3.
What are the key properties of [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate?
[9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate has a molecular weight of 366.45 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [9-[cyclohexyloxy(hydroxy)methyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylbutanoate is sourced from PubChem (CID 163568957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).