C25H33N5O3 — CID 163570570
5-amino-3-[4-[4-[3-(2,2-dimethylpropyl)-1,2-oxazol-5-yl]-3-oxobutan-2-yl]phenyl]-1-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazole-4-carboxamide (PubChem CID 163570570) has the molecular formula C25H33N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 5-amino-3-[4-[4-[3-(2,2-dimethylpropyl)-1,2-oxazol-5-yl]-3-oxobutan-2-yl]phenyl]-1-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-[4-[3-(2,2-dimethylpropyl)-1,2-oxazol-5-yl]-3-oxobutan-2-yl]phenyl]-1-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 163570570 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 5-amino-3-[4-[4-[3-(2,2-dimethylpropyl)-1,2-oxazol-5-yl]-3-oxobutan-2-yl]phenyl]-1-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazole-4-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])(C)n1nc(-c2ccc(C(C)C(=O)Cc3cc(CC(C)(C)C)no3)cc2)c(C(N)=O)c1N |
| InChI | InChI=1S/C25H33N5O3/c1-14(2)30-23(26)21(24(27)32)22(28-30)17-9-7-16(8-10-17)15(3)20(31)12-19-11-18(29-33-19)13-25(4,5)6/h7-11,14-15H,12-13,26H2,1-6H3,(H2,27,32)/i1D3,14D |
| InChIKey | FYZFNWAJMNFCBG-CZEVESCESA-N |
| XLogP | 4.30 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |