C20H20N4O4 — CID 163570831
3-cyclopropyl-5-[[(E)-2-methoxyethenyl]amino]-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 163570831) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-cyclopropyl-5-[[(E)-2-methoxyethenyl]amino]-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-5-[[(E)-2-methoxyethenyl]amino]-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 163570831 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-cyclopropyl-5-[[(E)-2-methoxyethenyl]amino]-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CO/C=C/Nc1cc(=O)n(C)c2c1c(=O)n(C1CC1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C20H20N4O4/c1-22-16(25)12-15(21-10-11-28-2)17-18(22)23(13-6-4-3-5-7-13)20(27)24(19(17)26)14-8-9-14/h3-7,10-12,14,21H,8-9H2,1-2H3/b11-10+ |
| InChIKey | FZEQIZYUJAUIAF-ZHACJKMWSA-N |
| XLogP | 1.72 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|