C13H22BrNO6 — CID 163571246
4-bromo-5-[2-[carboxymethyl(methyl)amino]ethoxy]-2,2,4-trimethyl-5-oxopentanoic acid (PubChem CID 163571246) has the molecular formula C13H22BrNO6 and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-bromo-5-[2-[carboxymethyl(methyl)amino]ethoxy]-2,2,4-trimethyl-5-oxopentanoic acid.
| Compound Name | 4-bromo-5-[2-[carboxymethyl(methyl)amino]ethoxy]-2,2,4-trimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163571246 |
| Molecular Formula | C13H22BrNO6 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-bromo-5-[2-[carboxymethyl(methyl)amino]ethoxy]-2,2,4-trimethyl-5-oxopentanoic acid |
| SMILES | CN(CCOC(=O)C(C)(Br)CC(C)(C)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H22BrNO6/c1-12(2,10(18)19)8-13(3,14)11(20)21-6-5-15(4)7-9(16)17/h5-8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | FZNKSSNDLQLUIU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|