C25H26N4O2S — CID 163571886
[(5-methyl-1,3-thiazol-2-yl)amino]-[2-(3-piperidin-4-yloxyphenyl)quinolin-8-yl]methanol (PubChem CID 163571886) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is [(5-methyl-1,3-thiazol-2-yl)amino]-[2-(3-piperidin-4-yloxyphenyl)quinolin-8-yl]methanol.
| Compound Name | [(5-methyl-1,3-thiazol-2-yl)amino]-[2-(3-piperidin-4-yloxyphenyl)quinolin-8-yl]methanol |
|---|---|
| PubChem CID | 163571886 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [(5-methyl-1,3-thiazol-2-yl)amino]-[2-(3-piperidin-4-yloxyphenyl)quinolin-8-yl]methanol |
| SMILES | Cc1cnc(NC(O)c2cccc3ccc(-c4cccc(OC5CCNCC5)c4)nc23)s1 |
| InChI | InChI=1S/C25H26N4O2S/c1-16-15-27-25(32-16)29-24(30)21-7-3-4-17-8-9-22(28-23(17)21)18-5-2-6-20(14-18)31-19-10-12-26-13-11-19/h2-9,14-15,19,24,26,30H,10-13H2,1H3,(H,27,29) |
| InChIKey | GABBFKAHCMYIRX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|