C10H13F5N2 — CID 163572135
4-(2,2-difluoropropylimino)-1,1,1-trifluoro-5-methylhexa-2,5-dien-2-amine (PubChem CID 163572135) has the molecular formula C10H13F5N2 and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-(2,2-difluoropropylimino)-1,1,1-trifluoro-5-methylhexa-2,5-dien-2-amine.
| Compound Name | 4-(2,2-difluoropropylimino)-1,1,1-trifluoro-5-methylhexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 163572135 |
| Molecular Formula | C10H13F5N2 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-(2,2-difluoropropylimino)-1,1,1-trifluoro-5-methylhexa-2,5-dien-2-amine |
| SMILES | C=C(C)/C(C=C(N)C(F)(F)F)=N\CC(C)(F)F |
| InChI | InChI=1S/C10H13F5N2/c1-6(2)7(17-5-9(3,11)12)4-8(16)10(13,14)15/h4H,1,5,16H2,2-3H3/b8-4?,17-7- |
| InChIKey | GKICPUSYQCHKJK-HXRBSPJMSA-N |
| XLogP | 3.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|