C18H26INO3 — CID 163572990
N-acetyl-N-[(1R,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexyl]propanamide (PubChem CID 163572990) has the molecular formula C18H26INO3 and a molecular weight of 431.31 g/mol. Its IUPAC name is N-acetyl-N-[(1R,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexyl]propanamide.
| Compound Name | N-acetyl-N-[(1R,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 163572990 |
| Molecular Formula | C18H26INO3 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-acetyl-N-[(1R,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexyl]propanamide |
| SMILES | CCC(=O)N(C(C)=O)[C@@H]1CCCC[C@H]1OCCC1=CC=IC=C1 |
| InChI | InChI=1S/C18H26INO3/c1-3-18(22)20(14(2)21)16-6-4-5-7-17(16)23-13-10-15-8-11-19-12-9-15/h8-9,11-12,16-17H,3-7,10,13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | GAZGZNWZLRKXJW-IAGOWNOFSA-N |
| XLogP | 3.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|