C19H30O2 — CID 163573256
[(4aR)-4-methoxy-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]-(1-bicyclo[2.2.1]heptanyl)methanol (PubChem CID 163573256) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(4aR)-4-methoxy-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]-(1-bicyclo[2.2.1]heptanyl)methanol.
| Compound Name | [(4aR)-4-methoxy-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]-(1-bicyclo[2.2.1]heptanyl)methanol |
|---|---|
| PubChem CID | 163573256 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(4aR)-4-methoxy-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]-(1-bicyclo[2.2.1]heptanyl)methanol |
| SMILES | COC1CCC(C(O)C23CCC(CC2)C3)C2CC=CC[C@@H]12 |
| InChI | InChI=1S/C19H30O2/c1-21-17-7-6-16(14-4-2-3-5-15(14)17)18(20)19-10-8-13(12-19)9-11-19/h2-3,13-18,20H,4-12H2,1H3/t13?,14?,15-,16?,17?,18?,19?/m1/s1 |
| InChIKey | GBFKBJAUBQOVBZ-BFMBOEQASA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|