C42H26O16 — CID 163573401
9-(3-dibenzofuran-1-ylphenyl)-10-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)anthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 163573401) has the molecular formula C42H26O16 and a molecular weight of 786.65 g/mol. Its IUPAC name is 9-(3-dibenzofuran-1-ylphenyl)-10-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)anthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(3-dibenzofuran-1-ylphenyl)-10-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)anthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 163573401 |
| Molecular Formula | C42H26O16 |
| Molecular Weight | 786.65 g/mol |
| Exact Mass | 786.12 |
| IUPAC Name | 9-(3-dibenzofuran-1-ylphenyl)-10-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)anthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3c4c(O)c(O)c(O)c(O)c4c(-c4cccc(-c5cccc6oc7ccccc7c56)c4)c4c(O)c(O)c(O)c(O)c34)c(O)c(O)c(O)c2c1O |
| InChI | InChI=1S/C42H26O16/c43-28-21-18(13-6-3-5-12(11-13)14-8-4-10-17-19(14)15-7-1-2-9-16(15)58-17)22-24(32(47)40(55)38(53)29(22)44)20(23(21)31(46)39(54)37(28)52)25-26-27(34(49)36(51)30(25)45)35(50)42(57)41(56)33(26)48/h1-11,43-57H |
| InChIKey | GBIOBXFRNXOFBK-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 316.59 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.65 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|