About (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine
(2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine (PubChem CID 163573971) has the molecular formula C16H23NOS2
and a molecular weight of 309.50 g/mol. Its IUPAC name is (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine.
Molecular Properties
| Compound Name | (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine |
| PubChem CID | 163573971 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine |
| SMILES | CC(C)C1([C@@]2(N)SCC(c3ccccc3)S2)CCCO1 |
| InChI | InChI=1S/C16H23NOS2/c1-12(2)15(9-6-10-18-15)16(17)19-11-14(20-16)13-7-4-3-5-8-13/h3-5,7-8,12,14H,6,9-11,17H2,1-2H3/t14?,15?,16-/m1/s1 |
| InChIKey | GBUUYIZRYVLYFU-UYSNPLJNSA-N |
| XLogP | 4.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine?
The IUPAC name of (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine (CID 163573971) is (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine.
What is the SMILES notation for (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine?
The canonical SMILES for (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine is CC(C)C1([C@@]2(N)SCC(c3ccccc3)S2)CCCO1.
What is the InChIKey of (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine?
The InChIKey is GBUUYIZRYVLYFU-UYSNPLJNSA-N. The full InChI is InChI=1S/C16H23NOS2/c1-12(2)15(9-6-10-18-15)16(17)19-11-14(20-16)13-7-4-3-5-8-13/h3-5,7-8,12,14H,6,9-11,17H2,1-2H3/t14?,15?,16-/m1/s1.
What are the key properties of (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine?
(2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine has a molecular weight of 309.50 g/mol, XLogP of 4.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-phenyl-2-(2-propan-2-yloxolan-2-yl)-1,3-dithiolan-2-amine is sourced from PubChem (CID 163573971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).