About 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol
1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol (PubChem CID 163574953) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol |
| PubChem CID | 163574953 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol |
| SMILES | CC(O)n1cnnc1-c1cccc(N)n1 |
| InChI | InChI=1S/C9H11N5O/c1-6(15)14-5-11-13-9(14)7-3-2-4-8(10)12-7/h2-6,15H,1H3,(H2,10,12) |
| InChIKey | GCQYTCYEDBMDNM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol?
The IUPAC name of 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol (CID 163574953) is 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol.
What is the SMILES notation for 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol?
The canonical SMILES for 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol is CC(O)n1cnnc1-c1cccc(N)n1.
What is the InChIKey of 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol?
The InChIKey is GCQYTCYEDBMDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-6(15)14-5-11-13-9(14)7-3-2-4-8(10)12-7/h2-6,15H,1H3,(H2,10,12).
What are the key properties of 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol?
1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol has a molecular weight of 205.22 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]ethanol is sourced from PubChem (CID 163574953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).