C15H19F9N2S3 — CID 163575098
1-(2,2-dimethylpropyl)-4-methylsulfanyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-5-sulfanylimidazole-2-thione (PubChem CID 163575098) has the molecular formula C15H19F9N2S3 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-methylsulfanyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-5-sulfanylimidazole-2-thione.
| Compound Name | 1-(2,2-dimethylpropyl)-4-methylsulfanyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-5-sulfanylimidazole-2-thione |
|---|---|
| PubChem CID | 163575098 |
| Molecular Formula | C15H19F9N2S3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-methylsulfanyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-5-sulfanylimidazole-2-thione |
| SMILES | CSc1c(S)n(CC(C)(C)C)c(=S)n1CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F9N2S3/c1-11(2,3)7-26-8(27)9(29-4)25(10(26)28)6-5-12(16,17)13(18,19)14(20,21)15(22,23)24/h27H,5-7H2,1-4H3 |
| InChIKey | GCTSGWGXUMGMKA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|