C14H19IN2 — CID 163575422
(9-iodo-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methanamine (PubChem CID 163575422) has the molecular formula C14H19IN2 and a molecular weight of 342.22 g/mol. Its IUPAC name is (9-iodo-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methanamine.
| Compound Name | (9-iodo-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methanamine |
|---|---|
| PubChem CID | 163575422 |
| Molecular Formula | C14H19IN2 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (9-iodo-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methanamine |
| SMILES | NCC1CCN2CCc3cc(I)ccc3C2C1 |
| InChI | InChI=1S/C14H19IN2/c15-12-1-2-13-11(8-12)4-6-17-5-3-10(9-16)7-14(13)17/h1-2,8,10,14H,3-7,9,16H2 |
| InChIKey | GDAQSCWASWOFGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|